C30H57N5O8 — CID 160650527
N'-hexyl-N'-hydroxy-N-[5-[hydroxy-[4-[5-[hydroxy(4-methylpentanoyl)amino]pentylamino]-4-oxobutanoyl]amino]pentyl]butanediamide (PubChem CID 160650527) has the molecular formula C30H57N5O8 and a molecular weight of 615.81 g/mol. Its IUPAC name is N'-hexyl-N'-hydroxy-N-[5-[hydroxy-[4-[5-[hydroxy(4-methylpentanoyl)amino]pentylamino]-4-oxobutanoyl]amino]pentyl]butanediamide.
| Compound Name | N'-hexyl-N'-hydroxy-N-[5-[hydroxy-[4-[5-[hydroxy(4-methylpentanoyl)amino]pentylamino]-4-oxobutanoyl]amino]pentyl]butanediamide |
|---|---|
| PubChem CID | 160650527 |
| Molecular Formula | C30H57N5O8 |
| Molecular Weight | 615.81 g/mol |
| Exact Mass | 615.42 |
| IUPAC Name | N'-hexyl-N'-hydroxy-N-[5-[hydroxy-[4-[5-[hydroxy(4-methylpentanoyl)amino]pentylamino]-4-oxobutanoyl]amino]pentyl]butanediamide |
| SMILES | CCCCCCN(O)C(=O)CCC(=O)NCCCCCN(O)C(=O)CCC(=O)NCCCCCN(O)C(=O)CCC(C)C |
| InChI | InChI=1S/C30H57N5O8/c1-4-5-6-11-22-34(42)29(39)18-15-26(36)32-21-10-8-13-24-35(43)30(40)19-16-27(37)31-20-9-7-12-23-33(41)28(38)17-14-25(2)3/h25,41-43H,4-24H2,1-3H3,(H,31,37)(H,32,36) |
| InChIKey | RKIXHMODGAYARG-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 179.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.81 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|