C28H54N6O8 — CID 101086377
N-[5-[acetyl(hydroxy)amino]pentyl]-N'-hydroxy-N'-[5-[[4-[hydroxy-[5-(propylamino)pentyl]amino]-4-oxobutanoyl]amino]pentyl]butanediamide (PubChem CID 101086377) has the molecular formula C28H54N6O8 and a molecular weight of 602.77 g/mol. Its IUPAC name is N-[5-[acetyl(hydroxy)amino]pentyl]-N'-hydroxy-N'-[5-[[4-[hydroxy-[5-(propylamino)pentyl]amino]-4-oxobutanoyl]amino]pentyl]butanediamide.
| Compound Name | N-[5-[acetyl(hydroxy)amino]pentyl]-N'-hydroxy-N'-[5-[[4-[hydroxy-[5-(propylamino)pentyl]amino]-4-oxobutanoyl]amino]pentyl]butanediamide |
|---|---|
| PubChem CID | 101086377 |
| Molecular Formula | C28H54N6O8 |
| Molecular Weight | 602.77 g/mol |
| Exact Mass | 602.40 |
| IUPAC Name | N-[5-[acetyl(hydroxy)amino]pentyl]-N'-hydroxy-N'-[5-[[4-[hydroxy-[5-(propylamino)pentyl]amino]-4-oxobutanoyl]amino]pentyl]butanediamide |
| SMILES | CCCNCCCCCN(O)C(=O)CCC(=O)NCCCCCN(O)C(=O)CCC(=O)NCCCCCN(O)C(C)=O |
| InChI | InChI=1S/C28H54N6O8/c1-3-17-29-18-7-4-11-22-33(41)27(38)15-13-26(37)31-20-9-6-12-23-34(42)28(39)16-14-25(36)30-19-8-5-10-21-32(40)24(2)35/h29,40-42H,3-23H2,1-2H3,(H,30,36)(H,31,37) |
| InChIKey | CBFFXZLXUKZEOS-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 191.85 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.77 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|