C38H66N6O9 — CID 46180263
N-[5-[acetyl(hydroxy)amino]pentyl]-N'-[5-[[4-[5-[[(3R,5S)-3,5-dimethyladamantane-1-carbonyl]amino]pentyl-hydroxyamino]-4-oxobutanoyl]amino]pentyl]-N'-hydroxybutanediamide (PubChem CID 46180263) has the molecular formula C38H66N6O9 and a molecular weight of 750.98 g/mol. Its IUPAC name is N-[5-[acetyl(hydroxy)amino]pentyl]-N'-[5-[[4-[5-[[(3R,5S)-3,5-dimethyladamantane-1-carbonyl]amino]pentyl-hydroxyamino]-4-oxobutanoyl]amino]pentyl]-N'-hydroxybutanediamide.
| Compound Name | N-[5-[acetyl(hydroxy)amino]pentyl]-N'-[5-[[4-[5-[[(3R,5S)-3,5-dimethyladamantane-1-carbonyl]amino]pentyl-hydroxyamino]-4-oxobutanoyl]amino]pentyl]-N'-hydroxybutanediamide |
|---|---|
| PubChem CID | 46180263 |
| Molecular Formula | C38H66N6O9 |
| Molecular Weight | 750.98 g/mol |
| Exact Mass | 750.49 |
| IUPAC Name | N-[5-[acetyl(hydroxy)amino]pentyl]-N'-[5-[[4-[5-[[(3R,5S)-3,5-dimethyladamantane-1-carbonyl]amino]pentyl-hydroxyamino]-4-oxobutanoyl]amino]pentyl]-N'-hydroxybutanediamide |
| SMILES | CC(=O)N(O)CCCCCNC(=O)CCC(=O)N(O)CCCCCNC(=O)CCC(=O)N(O)CCCCCNC(=O)C12CC3C[C@@](C)(C1)C[C@](C)(C3)C2 |
| InChI | InChI=1S/C38H66N6O9/c1-29(45)42(51)20-10-4-7-17-39-31(46)13-15-33(48)43(52)21-11-5-8-18-40-32(47)14-16-34(49)44(53)22-12-6-9-19-41-35(50)38-25-30-23-36(2,27-38)26-37(3,24-30)28-38/h30,51-53H,4-28H2,1-3H3,(H,39,46)(H,40,47)(H,41,50)/t30?,36-,37+,38? |
| InChIKey | MFAUREOOURUGSY-IESZRZKVSA-N |
| XLogP | 4.08 |
| TPSA | 208.92 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.98 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|