C16H27NO — CID 98075814
(3R,5R)-3,5-dimethyl-N-propyladamantane-1-carboxamide (PubChem CID 98075814) has the molecular formula C16H27NO and a molecular weight of 249.40 g/mol. Its IUPAC name is (3R,5R)-3,5-dimethyl-N-propyladamantane-1-carboxamide.
| Compound Name | (3R,5R)-3,5-dimethyl-N-propyladamantane-1-carboxamide |
|---|---|
| PubChem CID | 98075814 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | (3R,5R)-3,5-dimethyl-N-propyladamantane-1-carboxamide |
| SMILES | CCCNC(=O)C12CC3C[C@@](C)(C1)C[C@@](C)(C3)C2 |
| InChI | InChI=1S/C16H27NO/c1-4-5-17-13(18)16-8-12-6-14(2,10-16)9-15(3,7-12)11-16/h12H,4-11H2,1-3H3,(H,17,18)/t12?,14-,15-,16?/m1/s1 |
| InChIKey | VITZOZFJARCLCR-OYPFRJMLSA-N |
| XLogP | 3.51 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |