C18H31NO2 — CID 115700827
N-(2-hydroxypentyl)-3,5-dimethyladamantane-1-carboxamide (PubChem CID 115700827) has the molecular formula C18H31NO2 and a molecular weight of 293.45 g/mol. Its IUPAC name is N-(2-hydroxypentyl)-3,5-dimethyladamantane-1-carboxamide.
| Compound Name | N-(2-hydroxypentyl)-3,5-dimethyladamantane-1-carboxamide |
|---|---|
| PubChem CID | 115700827 |
| Molecular Formula | C18H31NO2 |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.24 |
| IUPAC Name | N-(2-hydroxypentyl)-3,5-dimethyladamantane-1-carboxamide |
| SMILES | CCCC(O)CNC(=O)C12CC3CC(C)(CC(C)(C3)C1)C2 |
| InChI | InChI=1S/C18H31NO2/c1-4-5-14(20)9-19-15(21)18-8-13-6-16(2,11-18)10-17(3,7-13)12-18/h13-14,20H,4-12H2,1-3H3,(H,19,21) |
| InChIKey | SUVIWISGWCUCDZ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |