C18H31NO2 — CID 107155296
N-(2-hydroxy-4-methylpentyl)-3-methyladamantane-1-carboxamide (PubChem CID 107155296) has the molecular formula C18H31NO2 and a molecular weight of 293.45 g/mol. Its IUPAC name is N-(2-hydroxy-4-methylpentyl)-3-methyladamantane-1-carboxamide.
| Compound Name | N-(2-hydroxy-4-methylpentyl)-3-methyladamantane-1-carboxamide |
|---|---|
| PubChem CID | 107155296 |
| Molecular Formula | C18H31NO2 |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.24 |
| IUPAC Name | N-(2-hydroxy-4-methylpentyl)-3-methyladamantane-1-carboxamide |
| SMILES | CC(C)CC(O)CNC(=O)C12CC3CC(CC(C)(C3)C1)C2 |
| InChI | InChI=1S/C18H31NO2/c1-12(2)4-15(20)10-19-16(21)18-8-13-5-14(9-18)7-17(3,6-13)11-18/h12-15,20H,4-11H2,1-3H3,(H,19,21) |
| InChIKey | VLBGRNQJTDKYPZ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |