C15H23NO3 — CID 113402725
2-[(3-methyladamantane-1-carbonyl)amino]propanoic acid (PubChem CID 113402725) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is 2-[(3-methyladamantane-1-carbonyl)amino]propanoic acid.
| Compound Name | 2-[(3-methyladamantane-1-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 113402725 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | 2-[(3-methyladamantane-1-carbonyl)amino]propanoic acid |
| SMILES | CC(NC(=O)C12CC3CC(CC(C)(C3)C1)C2)C(=O)O |
| InChI | InChI=1S/C15H23NO3/c1-9(12(17)18)16-13(19)15-6-10-3-11(7-15)5-14(2,4-10)8-15/h9-11H,3-8H2,1-2H3,(H,16,19)(H,17,18) |
| InChIKey | NPSGFDFVRSDIBS-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |