C16H27NO — CID 92532292
(3R,5S)-3,5-dimethyl-N-propan-2-yladamantane-1-carboxamide (PubChem CID 92532292) has the molecular formula C16H27NO and a molecular weight of 249.40 g/mol. Its IUPAC name is (3R,5S)-3,5-dimethyl-N-propan-2-yladamantane-1-carboxamide.
| Compound Name | (3R,5S)-3,5-dimethyl-N-propan-2-yladamantane-1-carboxamide |
|---|---|
| PubChem CID | 92532292 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | (3R,5S)-3,5-dimethyl-N-propan-2-yladamantane-1-carboxamide |
| SMILES | CC(C)NC(=O)C12CC3C[C@@](C)(C1)C[C@](C)(C3)C2 |
| InChI | InChI=1S/C16H27NO/c1-11(2)17-13(18)16-7-12-5-14(3,9-16)8-15(4,6-12)10-16/h11-12H,5-10H2,1-4H3,(H,17,18)/t12?,14-,15+,16? |
| InChIKey | AWQYXNIHVHNZDE-PYCGDYPRSA-N |
| XLogP | 3.51 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |