C17H29NO2 — CID 103919782
N-[(2R)-1-hydroxybutan-2-yl]-3,5-dimethyladamantane-1-carboxamide (PubChem CID 103919782) has the molecular formula C17H29NO2 and a molecular weight of 279.42 g/mol. Its IUPAC name is N-[(2R)-1-hydroxybutan-2-yl]-3,5-dimethyladamantane-1-carboxamide.
| Compound Name | N-[(2R)-1-hydroxybutan-2-yl]-3,5-dimethyladamantane-1-carboxamide |
|---|---|
| PubChem CID | 103919782 |
| Molecular Formula | C17H29NO2 |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.22 |
| IUPAC Name | N-[(2R)-1-hydroxybutan-2-yl]-3,5-dimethyladamantane-1-carboxamide |
| SMILES | CC[C@H](CO)NC(=O)C12CC3CC(C)(CC(C)(C3)C1)C2 |
| InChI | InChI=1S/C17H29NO2/c1-4-13(8-19)18-14(20)17-7-12-5-15(2,10-17)9-16(3,6-12)11-17/h12-13,19H,4-11H2,1-3H3,(H,18,20)/t12?,13-,15?,16?,17?/m1/s1 |
| InChIKey | QKDOHIJUZXTCEO-BOSJHMNHSA-N |
| XLogP | 2.87 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |