C14H23NO3 — CID 65315657
N-(1,3-dihydroxypropan-2-yl)adamantane-1-carboxamide (PubChem CID 65315657) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is N-(1,3-dihydroxypropan-2-yl)adamantane-1-carboxamide.
| Compound Name | N-(1,3-dihydroxypropan-2-yl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 65315657 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | N-(1,3-dihydroxypropan-2-yl)adamantane-1-carboxamide |
| SMILES | O=C(NC(CO)CO)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C14H23NO3/c16-7-12(8-17)15-13(18)14-4-9-1-10(5-14)3-11(2-9)6-14/h9-12,16-17H,1-8H2,(H,15,18) |
| InChIKey | HHQHQOSFWXLSGW-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |