C27H42N2O2 — CID 7418135
N-[(3S)-3-(adamantane-1-carbonylamino)pentyl]adamantane-1-carboxamide (PubChem CID 7418135) has the molecular formula C27H42N2O2 and a molecular weight of 426.65 g/mol. Its IUPAC name is N-[(3S)-3-(adamantane-1-carbonylamino)pentyl]adamantane-1-carboxamide.
| Compound Name | N-[(3S)-3-(adamantane-1-carbonylamino)pentyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 7418135 |
| Molecular Formula | C27H42N2O2 |
| Molecular Weight | 426.65 g/mol |
| Exact Mass | 426.32 |
| IUPAC Name | N-[(3S)-3-(adamantane-1-carbonylamino)pentyl]adamantane-1-carboxamide |
| SMILES | CC[C@@H](CCNC(=O)C12CC3CC(CC(C3)C1)C2)NC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C27H42N2O2/c1-2-23(29-25(31)27-14-20-8-21(15-27)10-22(9-20)16-27)3-4-28-24(30)26-11-17-5-18(12-26)7-19(6-17)13-26/h17-23H,2-16H2,1H3,(H,28,30)(H,29,31)/t17?,18?,19?,20?,21?,22?,23-,26?,27?/m0/s1 |
| InChIKey | SUKFVSRXNOIQTN-CQTINVLISA-N |
| XLogP | 4.82 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.65 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |