C23H35NO — CID 7065184
N-[(1R)-1-(1-adamantyl)ethyl]adamantane-1-carboxamide (PubChem CID 7065184) has the molecular formula C23H35NO and a molecular weight of 341.54 g/mol. Its IUPAC name is N-[(1R)-1-(1-adamantyl)ethyl]adamantane-1-carboxamide.
| Compound Name | N-[(1R)-1-(1-adamantyl)ethyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 7065184 |
| Molecular Formula | C23H35NO |
| Molecular Weight | 341.54 g/mol |
| Exact Mass | 341.27 |
| IUPAC Name | N-[(1R)-1-(1-adamantyl)ethyl]adamantane-1-carboxamide |
| SMILES | C[C@@H](NC(=O)C12CC3CC(CC(C3)C1)C2)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H35NO/c1-14(22-8-15-2-16(9-22)4-17(3-15)10-22)24-21(25)23-11-18-5-19(12-23)7-20(6-18)13-23/h14-20H,2-13H2,1H3,(H,24,25)/t14-,15?,16?,17?,18?,19?,20?,22?,23?/m1/s1 |
| InChIKey | ZHERTNHFOYXQJR-BROGYYQTSA-N |
| XLogP | 4.92 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.54 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |