C15H23Cl2NO — CID 7741613
N-[(1S)-1-(1-adamantyl)ethyl]-2,2-dichloropropanamide (PubChem CID 7741613) has the molecular formula C15H23Cl2NO and a molecular weight of 304.26 g/mol. Its IUPAC name is N-[(1S)-1-(1-adamantyl)ethyl]-2,2-dichloropropanamide.
| Compound Name | N-[(1S)-1-(1-adamantyl)ethyl]-2,2-dichloropropanamide |
|---|---|
| PubChem CID | 7741613 |
| Molecular Formula | C15H23Cl2NO |
| Molecular Weight | 304.26 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | N-[(1S)-1-(1-adamantyl)ethyl]-2,2-dichloropropanamide |
| SMILES | C[C@H](NC(=O)C(C)(Cl)Cl)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C15H23Cl2NO/c1-9(18-13(19)14(2,16)17)15-6-10-3-11(7-15)5-12(4-10)8-15/h9-12H,3-8H2,1-2H3,(H,18,19)/t9-,10?,11?,12?,15?/m0/s1 |
| InChIKey | GIXFLVCLBSOLMW-RXOVYUGGSA-N |
| XLogP | 3.90 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.26 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|