C24H37NO — CID 7322047
2-(1-adamantyl)-N-[(1R)-1-(1-adamantyl)ethyl]acetamide (PubChem CID 7322047) has the molecular formula C24H37NO and a molecular weight of 355.57 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-[(1R)-1-(1-adamantyl)ethyl]acetamide.
| Compound Name | 2-(1-adamantyl)-N-[(1R)-1-(1-adamantyl)ethyl]acetamide |
|---|---|
| PubChem CID | 7322047 |
| Molecular Formula | C24H37NO |
| Molecular Weight | 355.57 g/mol |
| Exact Mass | 355.29 |
| IUPAC Name | 2-(1-adamantyl)-N-[(1R)-1-(1-adamantyl)ethyl]acetamide |
| SMILES | C[C@@H](NC(=O)CC12CC3CC(CC(C3)C1)C2)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C24H37NO/c1-15(24-11-19-5-20(12-24)7-21(6-19)13-24)25-22(26)14-23-8-16-2-17(9-23)4-18(3-16)10-23/h15-21H,2-14H2,1H3,(H,25,26)/t15-,16?,17?,18?,19?,20?,21?,23?,24?/m1/s1 |
| InChIKey | MARKNSVDHIUVIE-DMNDBZKBSA-N |
| XLogP | 5.31 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.57 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |