C16H24NO3- — CID 2192991
2-[(5S,7R)-3-[(1S)-1-acetamidoethyl]-1-adamantyl]acetate (PubChem CID 2192991) has the molecular formula C16H24NO3- and a molecular weight of 278.37 g/mol. Its IUPAC name is 2-[(5S,7R)-3-[(1S)-1-acetamidoethyl]-1-adamantyl]acetate.
| Compound Name | 2-[(5S,7R)-3-[(1S)-1-acetamidoethyl]-1-adamantyl]acetate |
|---|---|
| PubChem CID | 2192991 |
| Molecular Formula | C16H24NO3- |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | 2-[(5S,7R)-3-[(1S)-1-acetamidoethyl]-1-adamantyl]acetate |
| SMILES | CC(=O)N[C@@H](C)C12C[C@@H]3C[C@@H](CC(CC(=O)[O-])(C3)C1)C2 |
| InChI | InChI=1S/C16H25NO3/c1-10(17-11(2)18)16-6-12-3-13(7-16)5-15(4-12,9-16)8-14(19)20/h10,12-13H,3-9H2,1-2H3,(H,17,18)(H,19,20)/p-1/t10-,12-,13+,15?,16?/m0/s1 |
| InChIKey | FILJOBLEUYFETE-MOKSEWLOSA-M |
| XLogP | 1.24 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |