C22H38N2O2 — CID 7740968
N-[(2S)-butan-2-yl]-2-[3-[2-[[(2R)-butan-2-yl]amino]-2-oxoethyl]-1-adamantyl]acetamide (PubChem CID 7740968) has the molecular formula C22H38N2O2 and a molecular weight of 362.56 g/mol. Its IUPAC name is N-[(2S)-butan-2-yl]-2-[3-[2-[[(2R)-butan-2-yl]amino]-2-oxoethyl]-1-adamantyl]acetamide.
| Compound Name | N-[(2S)-butan-2-yl]-2-[3-[2-[[(2R)-butan-2-yl]amino]-2-oxoethyl]-1-adamantyl]acetamide |
|---|---|
| PubChem CID | 7740968 |
| Molecular Formula | C22H38N2O2 |
| Molecular Weight | 362.56 g/mol |
| Exact Mass | 362.29 |
| IUPAC Name | N-[(2S)-butan-2-yl]-2-[3-[2-[[(2R)-butan-2-yl]amino]-2-oxoethyl]-1-adamantyl]acetamide |
| SMILES | CC[C@@H](C)NC(=O)CC12CC3CC(C1)CC(CC(=O)N[C@@H](C)CC)(C3)C2 |
| InChI | InChI=1S/C22H38N2O2/c1-5-15(3)23-19(25)12-21-8-17-7-18(9-21)11-22(10-17,14-21)13-20(26)24-16(4)6-2/h15-18H,5-14H2,1-4H3,(H,23,25)(H,24,26)/t15-,16+,17?,18?,21?,22? |
| InChIKey | NPNUTFMKWBAEBC-CMXHAEJISA-N |
| XLogP | 4.18 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.56 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |