C13H19O2- — CID 5175229
2-(3-methyl-1-adamantyl)acetate (PubChem CID 5175229) has the molecular formula C13H19O2- and a molecular weight of 207.29 g/mol. Its IUPAC name is 2-(3-methyl-1-adamantyl)acetate.
| Compound Name | 2-(3-methyl-1-adamantyl)acetate |
|---|---|
| PubChem CID | 5175229 |
| Molecular Formula | C13H19O2- |
| Molecular Weight | 207.29 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | 2-(3-methyl-1-adamantyl)acetate |
| SMILES | CC12CC3CC(C1)CC(CC(=O)[O-])(C3)C2 |
| InChI | InChI=1S/C13H20O2/c1-12-3-9-2-10(4-12)6-13(5-9,8-12)7-11(14)15/h9-10H,2-8H2,1H3,(H,14,15)/p-1 |
| InChIKey | OIASGIUDXARLDU-UHFFFAOYSA-M |
| XLogP | 1.73 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.29 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |