C13H20F2O3S — CID 123591688
1,1-difluoro-2-(3-methyl-1-adamantyl)ethanesulfonic acid (PubChem CID 123591688) has the molecular formula C13H20F2O3S and a molecular weight of 294.36 g/mol. Its IUPAC name is 1,1-difluoro-2-(3-methyl-1-adamantyl)ethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-(3-methyl-1-adamantyl)ethanesulfonic acid |
|---|---|
| PubChem CID | 123591688 |
| Molecular Formula | C13H20F2O3S |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 1,1-difluoro-2-(3-methyl-1-adamantyl)ethanesulfonic acid |
| SMILES | CC12CC3CC(C1)CC(CC(F)(F)S(=O)(=O)O)(C3)C2 |
| InChI | InChI=1S/C13H20F2O3S/c1-11-3-9-2-10(4-11)6-12(5-9,7-11)8-13(14,15)19(16,17)18/h9-10H,2-8H2,1H3,(H,16,17,18) |
| InChIKey | WIHHTGGBSTYPHZ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|