C12H16F2O3S — CID 147136377
1,1-difluoro-2-(5-tetracyclo[5.2.1.03,8.05,8]decanyl)ethanesulfonic acid (PubChem CID 147136377) has the molecular formula C12H16F2O3S and a molecular weight of 278.32 g/mol. Its IUPAC name is 1,1-difluoro-2-(5-tetracyclo[5.2.1.03,8.05,8]decanyl)ethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-(5-tetracyclo[5.2.1.03,8.05,8]decanyl)ethanesulfonic acid |
|---|---|
| PubChem CID | 147136377 |
| Molecular Formula | C12H16F2O3S |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 1,1-difluoro-2-(5-tetracyclo[5.2.1.03,8.05,8]decanyl)ethanesulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)CC12CC3CC4CC(C1)C32C4 |
| InChI | InChI=1S/C12H16F2O3S/c13-12(14,18(15,16)17)6-10-4-8-1-7-2-9(5-10)11(8,10)3-7/h7-9H,1-6H2,(H,15,16,17) |
| InChIKey | BRFVZQZHTSCNGM-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|