C14H20F2O6S — CID 88879168
2-(1-adamantylmethoxycarbonyloxy)-1,1-difluoroethanesulfonic acid (PubChem CID 88879168) has the molecular formula C14H20F2O6S and a molecular weight of 354.37 g/mol. Its IUPAC name is 2-(1-adamantylmethoxycarbonyloxy)-1,1-difluoroethanesulfonic acid.
| Compound Name | 2-(1-adamantylmethoxycarbonyloxy)-1,1-difluoroethanesulfonic acid |
|---|---|
| PubChem CID | 88879168 |
| Molecular Formula | C14H20F2O6S |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 2-(1-adamantylmethoxycarbonyloxy)-1,1-difluoroethanesulfonic acid |
| SMILES | O=C(OCC12CC3CC(CC(C3)C1)C2)OCC(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C14H20F2O6S/c15-14(16,23(18,19)20)8-22-12(17)21-7-13-4-9-1-10(5-13)3-11(2-9)6-13/h9-11H,1-8H2,(H,18,19,20) |
| InChIKey | UZDMFLSQHRAPAI-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|