C13H18F2O6S — CID 88594309
1,1-difluoro-2-(4-oxatricyclo[4.3.1.13,8]undecane-1-carbonyloxy)ethanesulfonic acid (PubChem CID 88594309) has the molecular formula C13H18F2O6S and a molecular weight of 340.34 g/mol. Its IUPAC name is 1,1-difluoro-2-(4-oxatricyclo[4.3.1.13,8]undecane-1-carbonyloxy)ethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-(4-oxatricyclo[4.3.1.13,8]undecane-1-carbonyloxy)ethanesulfonic acid |
|---|---|
| PubChem CID | 88594309 |
| Molecular Formula | C13H18F2O6S |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | 1,1-difluoro-2-(4-oxatricyclo[4.3.1.13,8]undecane-1-carbonyloxy)ethanesulfonic acid |
| SMILES | O=C(OCC(F)(F)S(=O)(=O)O)C12CC3COC(CC(C3)C1)C2 |
| InChI | InChI=1S/C13H18F2O6S/c14-13(15,22(17,18)19)7-21-11(16)12-3-8-1-9(4-12)6-20-10(2-8)5-12/h8-10H,1-7H2,(H,17,18,19) |
| InChIKey | LIEWVTQPGHLCTP-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|