C40H54F2O13S — CID 118910564
2-[5,5-bis[(3-hydroxyadamantane-1-carbonyl)oxymethyl]spiro[1,3-dioxane-2,4'-adamantane]-1'-carbonyl]oxy-1,1-difluoroethanesulfonic acid (PubChem CID 118910564) has the molecular formula C40H54F2O13S and a molecular weight of 812.92 g/mol. Its IUPAC name is 2-[5,5-bis[(3-hydroxyadamantane-1-carbonyl)oxymethyl]spiro[1,3-dioxane-2,4'-adamantane]-1'-carbonyl]oxy-1,1-difluoroethanesulfonic acid.
| Compound Name | 2-[5,5-bis[(3-hydroxyadamantane-1-carbonyl)oxymethyl]spiro[1,3-dioxane-2,4'-adamantane]-1'-carbonyl]oxy-1,1-difluoroethanesulfonic acid |
|---|---|
| PubChem CID | 118910564 |
| Molecular Formula | C40H54F2O13S |
| Molecular Weight | 812.92 g/mol |
| Exact Mass | 812.33 |
| IUPAC Name | 2-[5,5-bis[(3-hydroxyadamantane-1-carbonyl)oxymethyl]spiro[1,3-dioxane-2,4'-adamantane]-1'-carbonyl]oxy-1,1-difluoroethanesulfonic acid |
| SMILES | O=C(OCC(F)(F)S(=O)(=O)O)C12CC3CC(C1)C1(OCC(COC(=O)C45CC6CC(CC(O)(C6)C4)C5)(COC(=O)C45CC6CC(CC(O)(C6)C4)C5)CO1)C(C3)C2 |
| InChI | InChI=1S/C40H54F2O13S/c41-39(42,56(48,49)50)22-53-30(43)34-5-23-3-28(14-34)40(29(4-23)15-34)54-20-33(21-55-40,18-51-31(44)35-6-24-1-25(7-35)11-37(46,10-24)16-35)19-52-32(45)36-8-26-2-27(9-36)13-38(47,12-26)17-36/h23-29,46-47H,1-22H2,(H,48,49,50) |
| InChIKey | GTDKQOGUTKRROM-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 192.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.92 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|