C13H17F2NaO6S — CID 59185153
sodium 1,1-difluoro-2-(3-hydroxyadamantane-1-carbonyl)oxyethanesulfonate (PubChem CID 59185153) has the molecular formula C13H17F2NaO6S and a molecular weight of 362.33 g/mol. Its IUPAC name is sodium 1,1-difluoro-2-(3-hydroxyadamantane-1-carbonyl)oxyethanesulfonate.
| Compound Name | sodium 1,1-difluoro-2-(3-hydroxyadamantane-1-carbonyl)oxyethanesulfonate |
|---|---|
| PubChem CID | 59185153 |
| Molecular Formula | C13H17F2NaO6S |
| Molecular Weight | 362.33 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | sodium 1,1-difluoro-2-(3-hydroxyadamantane-1-carbonyl)oxyethanesulfonate |
| SMILES | O=C(OCC(F)(F)S(=O)(=O)[O-])C12CC3CC(CC(O)(C3)C1)C2.[Na+] |
| InChI | InChI=1S/C13H18F2O6S.Na/c14-13(15,22(18,19)20)7-21-10(16)11-2-8-1-9(3-11)5-12(17,4-8)6-11;/h8-9,17H,1-7H2,(H,18,19,20);/q;+1/p-1 |
| InChIKey | UGBMQOGWORZEGE-UHFFFAOYSA-M |
| XLogP | -2.00 |
| TPSA | 103.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.33 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|