C26H34BrF4NaO7S — CID 161498247
sodium;2-(adamantane-1-carbonyloxy)-1,1-difluoroethanesulfonate;(2-bromo-2,2-difluoroethyl) adamantane-1-carboxylate (PubChem CID 161498247) has the molecular formula C26H34BrF4NaO7S and a molecular weight of 669.50 g/mol. Its IUPAC name is sodium;2-(adamantane-1-carbonyloxy)-1,1-difluoroethanesulfonate;(2-bromo-2,2-difluoroethyl) adamantane-1-carboxylate.
| Compound Name | sodium;2-(adamantane-1-carbonyloxy)-1,1-difluoroethanesulfonate;(2-bromo-2,2-difluoroethyl) adamantane-1-carboxylate |
|---|---|
| PubChem CID | 161498247 |
| Molecular Formula | C26H34BrF4NaO7S |
| Molecular Weight | 669.50 g/mol |
| Exact Mass | 668.10 |
| IUPAC Name | sodium;2-(adamantane-1-carbonyloxy)-1,1-difluoroethanesulfonate;(2-bromo-2,2-difluoroethyl) adamantane-1-carboxylate |
| SMILES | O=C(OCC(F)(F)Br)C12CC3CC(CC(C3)C1)C2.O=C(OCC(F)(F)S(=O)(=O)[O-])C12CC3CC(CC(C3)C1)C2.[Na+] |
| InChI | InChI=1S/C13H17BrF2O2.C13H18F2O5S.Na/c14-13(15,16)7-18-11(17)12-4-8-1-9(5-12)3-10(2-8)6-12;14-13(15,21(17,18)19)7-20-11(16)12-4-8-1-9(5-12)3-10(2-8)6-12;/h8-10H,1-7H2;8-10H,1-7H2,(H,17,18,19);/q;;+1/p-1 |
| InChIKey | YEQYPMUURCLZET-UHFFFAOYSA-M |
| XLogP | 2.62 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.50 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|