C15H19BrF2O4 — CID 164579755
2-(2-bromo-2,2-difluoroacetyl)oxyethyl adamantane-1-carboxylate (PubChem CID 164579755) has the molecular formula C15H19BrF2O4 and a molecular weight of 381.21 g/mol. Its IUPAC name is 2-(2-bromo-2,2-difluoroacetyl)oxyethyl adamantane-1-carboxylate.
| Compound Name | 2-(2-bromo-2,2-difluoroacetyl)oxyethyl adamantane-1-carboxylate |
|---|---|
| PubChem CID | 164579755 |
| Molecular Formula | C15H19BrF2O4 |
| Molecular Weight | 381.21 g/mol |
| Exact Mass | 380.04 |
| IUPAC Name | 2-(2-bromo-2,2-difluoroacetyl)oxyethyl adamantane-1-carboxylate |
| SMILES | O=C(OCCOC(=O)C12CC3CC(CC(C3)C1)C2)C(F)(F)Br |
| InChI | InChI=1S/C15H19BrF2O4/c16-15(17,18)13(20)22-2-1-21-12(19)14-6-9-3-10(7-14)5-11(4-9)8-14/h9-11H,1-8H2 |
| InChIKey | XXQIWGTZPDGBOW-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.21 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|