C17H20F6O5 — CID 162508356
2-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoyl]oxyethyl adamantane-1-carboxylate (PubChem CID 162508356) has the molecular formula C17H20F6O5 and a molecular weight of 418.33 g/mol. Its IUPAC name is 2-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoyl]oxyethyl adamantane-1-carboxylate.
| Compound Name | 2-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoyl]oxyethyl adamantane-1-carboxylate |
|---|---|
| PubChem CID | 162508356 |
| Molecular Formula | C17H20F6O5 |
| Molecular Weight | 418.33 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | 2-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoyl]oxyethyl adamantane-1-carboxylate |
| SMILES | O=C(OCCOC(=O)C(O)(C(F)(F)F)C(F)(F)F)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C17H20F6O5/c18-16(19,20)15(26,17(21,22)23)13(25)28-2-1-27-12(24)14-6-9-3-10(7-14)5-11(4-9)8-14/h9-11,26H,1-8H2 |
| InChIKey | WETDRCKOKOZDAN-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.33 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|