C20H26F4O6 — CID 118910590
[1,1,2,2-tetrafluoro-3-[2-(2-methylpropanoyloxy)ethoxy]-3-oxopropyl] adamantane-1-carboxylate (PubChem CID 118910590) has the molecular formula C20H26F4O6 and a molecular weight of 438.41 g/mol. Its IUPAC name is [1,1,2,2-tetrafluoro-3-[2-(2-methylpropanoyloxy)ethoxy]-3-oxopropyl] adamantane-1-carboxylate.
| Compound Name | [1,1,2,2-tetrafluoro-3-[2-(2-methylpropanoyloxy)ethoxy]-3-oxopropyl] adamantane-1-carboxylate |
|---|---|
| PubChem CID | 118910590 |
| Molecular Formula | C20H26F4O6 |
| Molecular Weight | 438.41 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | [1,1,2,2-tetrafluoro-3-[2-(2-methylpropanoyloxy)ethoxy]-3-oxopropyl] adamantane-1-carboxylate |
| SMILES | CC(C)C(=O)OCCOC(=O)C(F)(F)C(F)(F)OC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C20H26F4O6/c1-11(2)15(25)28-3-4-29-17(27)19(21,22)20(23,24)30-16(26)18-8-12-5-13(9-18)7-14(6-12)10-18/h11-14H,3-10H2,1-2H3 |
| InChIKey | LZCBMSVMWPARQQ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.41 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|