C20H30F2O6 — CID 129106203
[1,1-difluoro-2-[2-(2-methylpropanoyloxy)ethoxy]-2-oxoethyl] 3,7-dimethylbicyclo[3.3.1]nonane-3-carboxylate (PubChem CID 129106203) has the molecular formula C20H30F2O6 and a molecular weight of 404.45 g/mol. Its IUPAC name is [1,1-difluoro-2-[2-(2-methylpropanoyloxy)ethoxy]-2-oxoethyl] 3,7-dimethylbicyclo[3.3.1]nonane-3-carboxylate.
| Compound Name | [1,1-difluoro-2-[2-(2-methylpropanoyloxy)ethoxy]-2-oxoethyl] 3,7-dimethylbicyclo[3.3.1]nonane-3-carboxylate |
|---|---|
| PubChem CID | 129106203 |
| Molecular Formula | C20H30F2O6 |
| Molecular Weight | 404.45 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | [1,1-difluoro-2-[2-(2-methylpropanoyloxy)ethoxy]-2-oxoethyl] 3,7-dimethylbicyclo[3.3.1]nonane-3-carboxylate |
| SMILES | CC1CC2CC(C1)CC(C)(C(=O)OC(F)(F)C(=O)OCCOC(=O)C(C)C)C2 |
| InChI | InChI=1S/C20H30F2O6/c1-12(2)16(23)26-5-6-27-18(25)20(21,22)28-17(24)19(4)10-14-7-13(3)8-15(9-14)11-19/h12-15H,5-11H2,1-4H3 |
| InChIKey | MDPKSGKIRLASIF-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.45 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|