C14H24O5 — CID 521167
2-(2-methylpropanoyloxy)ethyl 2,2,4-trimethyl-3-oxopentanoate (PubChem CID 521167) has the molecular formula C14H24O5 and a molecular weight of 272.34 g/mol. Its IUPAC name is 2-(2-methylpropanoyloxy)ethyl 2,2,4-trimethyl-3-oxopentanoate.
| Compound Name | 2-(2-methylpropanoyloxy)ethyl 2,2,4-trimethyl-3-oxopentanoate |
|---|---|
| PubChem CID | 521167 |
| Molecular Formula | C14H24O5 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 2-(2-methylpropanoyloxy)ethyl 2,2,4-trimethyl-3-oxopentanoate |
| SMILES | CC(C)C(=O)OCCOC(=O)C(C)(C)C(=O)C(C)C |
| InChI | InChI=1S/C14H24O5/c1-9(2)11(15)14(5,6)13(17)19-8-7-18-12(16)10(3)4/h9-10H,7-8H2,1-6H3 |
| InChIKey | KHCOOLZMVDKFHC-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|