C16H22F4O2 — CID 58122770
3,3,4,4-tetrafluoropentyl adamantane-1-carboxylate (PubChem CID 58122770) has the molecular formula C16H22F4O2 and a molecular weight of 322.34 g/mol. Its IUPAC name is 3,3,4,4-tetrafluoropentyl adamantane-1-carboxylate.
| Compound Name | 3,3,4,4-tetrafluoropentyl adamantane-1-carboxylate |
|---|---|
| PubChem CID | 58122770 |
| Molecular Formula | C16H22F4O2 |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | 3,3,4,4-tetrafluoropentyl adamantane-1-carboxylate |
| SMILES | CC(F)(F)C(F)(F)CCOC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C16H22F4O2/c1-14(17,18)16(19,20)2-3-22-13(21)15-7-10-4-11(8-15)6-12(5-10)9-15/h10-12H,2-9H2,1H3 |
| InChIKey | XYIVQLZAMRKIHQ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|