C23H29F9O4 — CID 121404691
[2-methyl-2-(3,3,4,4,5,5,6,6,6-nonafluorohexoxycarbonyl)butyl] adamantane-1-carboxylate (PubChem CID 121404691) has the molecular formula C23H29F9O4 and a molecular weight of 540.46 g/mol. Its IUPAC name is [2-methyl-2-(3,3,4,4,5,5,6,6,6-nonafluorohexoxycarbonyl)butyl] adamantane-1-carboxylate.
| Compound Name | [2-methyl-2-(3,3,4,4,5,5,6,6,6-nonafluorohexoxycarbonyl)butyl] adamantane-1-carboxylate |
|---|---|
| PubChem CID | 121404691 |
| Molecular Formula | C23H29F9O4 |
| Molecular Weight | 540.46 g/mol |
| Exact Mass | 540.19 |
| IUPAC Name | [2-methyl-2-(3,3,4,4,5,5,6,6,6-nonafluorohexoxycarbonyl)butyl] adamantane-1-carboxylate |
| SMILES | CCC(C)(COC(=O)C12CC3CC(CC(C3)C1)C2)C(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C23H29F9O4/c1-3-18(2,12-36-17(34)19-9-13-6-14(10-19)8-15(7-13)11-19)16(33)35-5-4-20(24,25)21(26,27)22(28,29)23(30,31)32/h13-15H,3-12H2,1-2H3 |
| InChIKey | RKAZIYBHMLQSRU-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.46 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|