C24H35F9O6 — CID 89467626
1-O-(3,3,4,4,5,5,6,6,6-nonafluorohexyl) 3-O-[[2,4,4-trimethyl-2-(2-methylbutan-2-yl)hexanoyl]oxymethyl] propanedioate (PubChem CID 89467626) has the molecular formula C24H35F9O6 and a molecular weight of 590.52 g/mol. Its IUPAC name is 1-O-(3,3,4,4,5,5,6,6,6-nonafluorohexyl) 3-O-[[2,4,4-trimethyl-2-(2-methylbutan-2-yl)hexanoyl]oxymethyl] propanedioate.
| Compound Name | 1-O-(3,3,4,4,5,5,6,6,6-nonafluorohexyl) 3-O-[[2,4,4-trimethyl-2-(2-methylbutan-2-yl)hexanoyl]oxymethyl] propanedioate |
|---|---|
| PubChem CID | 89467626 |
| Molecular Formula | C24H35F9O6 |
| Molecular Weight | 590.52 g/mol |
| Exact Mass | 590.23 |
| IUPAC Name | 1-O-(3,3,4,4,5,5,6,6,6-nonafluorohexyl) 3-O-[[2,4,4-trimethyl-2-(2-methylbutan-2-yl)hexanoyl]oxymethyl] propanedioate |
| SMILES | CCC(C)(C)CC(C)(C(=O)OCOC(=O)CC(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(C)(C)CC |
| InChI | InChI=1S/C24H35F9O6/c1-8-18(3,4)13-20(7,19(5,6)9-2)17(36)39-14-38-16(35)12-15(34)37-11-10-21(25,26)22(27,28)23(29,30)24(31,32)33/h8-14H2,1-7H3 |
| InChIKey | CKRYUAQFAZECTD-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.52 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|