C25H12F34O4 — CID 20678086
bis(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl) 2-methylidenebutanedioate (PubChem CID 20678086) has the molecular formula C25H12F34O4 and a molecular weight of 1022.30 g/mol. Its IUPAC name is bis(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl) 2-methylidenebutanedioate.
| Compound Name | bis(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl) 2-methylidenebutanedioate |
|---|---|
| PubChem CID | 20678086 |
| Molecular Formula | C25H12F34O4 |
| Molecular Weight | 1022.30 g/mol |
| Exact Mass | 1022.02 |
| IUPAC Name | bis(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl) 2-methylidenebutanedioate |
| SMILES | C=C(CC(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C25H12F34O4/c1-7(9(61)63-5-3-11(28,29)13(32,33)15(36,37)17(40,41)19(44,45)21(48,49)23(52,53)25(57,58)59)6-8(60)62-4-2-10(26,27)12(30,31)14(34,35)16(38,39)18(42,43)20(46,47)22(50,51)24(54,55)56/h1-6H2 |
| InChIKey | CUTJHVWHAABDGN-UHFFFAOYSA-N |
| XLogP | 11.82 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1022.30 |
| LogP ≤ 5 | 11.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|