C24H16F26O4 — CID 59449605
CID 59449605 (PubChem CID 59449605) has the molecular formula C24H16F26O4 and a molecular weight of 862.34 g/mol.
| Compound Name | CID 59449605 |
|---|---|
| PubChem CID | 59449605 |
| Molecular Formula | C24H16F26O4 |
| Molecular Weight | 862.34 g/mol |
| Exact Mass | 862.06 |
| IUPAC Name | — |
| SMILES | [CH]C(C)(CC(=C)C(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C24H16F26O4/c1-9(10(51)53-6-4-13(25,26)15(29,30)17(33,34)19(37,38)21(41,42)23(45,46)47)8-12(2,3)11(52)54-7-5-14(27,28)16(31,32)18(35,36)20(39,40)22(43,44)24(48,49)50/h2H,1,4-8H2,3H3 |
| InChIKey | OSZREJGENQKOTJ-UHFFFAOYSA-N |
| XLogP | 9.99 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 862.34 |
| LogP ≤ 5 | 9.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|