C10H5F15O3 — CID 88941429
3,3,4,4,5,5,6,6,6-nonafluorohexyl 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoate (PubChem CID 88941429) has the molecular formula C10H5F15O3 and a molecular weight of 458.12 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,6-nonafluorohexyl 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoate.
| Compound Name | 3,3,4,4,5,5,6,6,6-nonafluorohexyl 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoate |
|---|---|
| PubChem CID | 88941429 |
| Molecular Formula | C10H5F15O3 |
| Molecular Weight | 458.12 g/mol |
| Exact Mass | 458.00 |
| IUPAC Name | 3,3,4,4,5,5,6,6,6-nonafluorohexyl 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoate |
| SMILES | O=C(OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H5F15O3/c11-4(12,6(13,14)7(15,16)10(23,24)25)1-2-28-3(26)5(27,8(17,18)19)9(20,21)22/h27H,1-2H2 |
| InChIKey | BWKAQQBECOYBTN-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.12 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|