C16H13F18NO4 — CID 86219112
bis(3,3,4,4,5,5,6,6,6-nonafluorohexyl) 2-aminobutanedioate (PubChem CID 86219112) has the molecular formula C16H13F18NO4 and a molecular weight of 625.25 g/mol. Its IUPAC name is bis(3,3,4,4,5,5,6,6,6-nonafluorohexyl) 2-aminobutanedioate.
| Compound Name | bis(3,3,4,4,5,5,6,6,6-nonafluorohexyl) 2-aminobutanedioate |
|---|---|
| PubChem CID | 86219112 |
| Molecular Formula | C16H13F18NO4 |
| Molecular Weight | 625.25 g/mol |
| Exact Mass | 625.06 |
| IUPAC Name | bis(3,3,4,4,5,5,6,6,6-nonafluorohexyl) 2-aminobutanedioate |
| SMILES | NC(CC(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H13F18NO4/c17-9(18,11(21,22)13(25,26)15(29,30)31)1-3-38-7(36)5-6(35)8(37)39-4-2-10(19,20)12(23,24)14(27,28)16(32,33)34/h6H,1-5,35H2 |
| InChIKey | FVWUXDCBWUBLHP-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.25 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|