C25H25F26N2O4+ — CID 91329269
2-[[1,4-dioxo-1,4-bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxy)butan-2-yl]amino]ethyl-trimethylazanium (PubChem CID 91329269) has the molecular formula C25H25F26N2O4+ and a molecular weight of 911.43 g/mol. Its IUPAC name is 2-[[1,4-dioxo-1,4-bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxy)butan-2-yl]amino]ethyl-trimethylazanium.
| Compound Name | 2-[[1,4-dioxo-1,4-bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxy)butan-2-yl]amino]ethyl-trimethylazanium |
|---|---|
| PubChem CID | 91329269 |
| Molecular Formula | C25H25F26N2O4+ |
| Molecular Weight | 911.43 g/mol |
| Exact Mass | 911.14 |
| IUPAC Name | 2-[[1,4-dioxo-1,4-bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxy)butan-2-yl]amino]ethyl-trimethylazanium |
| SMILES | C[N+](C)(C)CCNC(CC(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C25H25F26N2O4/c1-53(2,3)7-6-52-11(13(55)57-9-5-15(28,29)17(32,33)19(36,37)21(40,41)23(44,45)25(49,50)51)10-12(54)56-8-4-14(26,27)16(30,31)18(34,35)20(38,39)22(42,43)24(46,47)48/h11,52H,4-10H2,1-3H3/q+1 |
| InChIKey | TZARFPYMEIPUQX-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 911.43 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|