C24H29F18N2O5+ — CID 58759223
[3-[[1,4-bis(4,4,5,5,6,6,7,7,7-nonafluoroheptoxy)-1,4-dioxobutan-2-yl]amino]-3-oxopropyl]-trimethylazanium (PubChem CID 58759223) has the molecular formula C24H29F18N2O5+ and a molecular weight of 767.47 g/mol. Its IUPAC name is [3-[[1,4-bis(4,4,5,5,6,6,7,7,7-nonafluoroheptoxy)-1,4-dioxobutan-2-yl]amino]-3-oxopropyl]-trimethylazanium.
| Compound Name | [3-[[1,4-bis(4,4,5,5,6,6,7,7,7-nonafluoroheptoxy)-1,4-dioxobutan-2-yl]amino]-3-oxopropyl]-trimethylazanium |
|---|---|
| PubChem CID | 58759223 |
| Molecular Formula | C24H29F18N2O5+ |
| Molecular Weight | 767.47 g/mol |
| Exact Mass | 767.18 |
| IUPAC Name | [3-[[1,4-bis(4,4,5,5,6,6,7,7,7-nonafluoroheptoxy)-1,4-dioxobutan-2-yl]amino]-3-oxopropyl]-trimethylazanium |
| SMILES | C[N+](C)(C)CCC(=O)NC(CC(=O)OCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)OCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C24H28F18N2O5/c1-44(2,3)9-6-14(45)43-13(16(47)49-11-5-8-18(27,28)20(31,32)22(35,36)24(40,41)42)12-15(46)48-10-4-7-17(25,26)19(29,30)21(33,34)23(37,38)39/h13H,4-12H2,1-3H3/p+1 |
| InChIKey | DAUCICNZBOZQHX-UHFFFAOYSA-O |
| XLogP | 6.54 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.47 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|