C16H19F13O2 — CID 21020702
6,6,7,7,8,8,9,9,10,10,11,11,11-tridecafluoroundecyl 2-methylbutanoate (PubChem CID 21020702) has the molecular formula C16H19F13O2 and a molecular weight of 490.30 g/mol. Its IUPAC name is 6,6,7,7,8,8,9,9,10,10,11,11,11-tridecafluoroundecyl 2-methylbutanoate.
| Compound Name | 6,6,7,7,8,8,9,9,10,10,11,11,11-tridecafluoroundecyl 2-methylbutanoate |
|---|---|
| PubChem CID | 21020702 |
| Molecular Formula | C16H19F13O2 |
| Molecular Weight | 490.30 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | 6,6,7,7,8,8,9,9,10,10,11,11,11-tridecafluoroundecyl 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OCCCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H19F13O2/c1-3-9(2)10(30)31-8-6-4-5-7-11(17,18)12(19,20)13(21,22)14(23,24)15(25,26)16(27,28)29/h9H,3-8H2,1-2H3 |
| InChIKey | HOXDAANJNLLICM-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.30 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|