C13H11F13O2 — CID 52991911
5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluorodecyl prop-2-enoate (PubChem CID 52991911) has the molecular formula C13H11F13O2 and a molecular weight of 446.20 g/mol. Its IUPAC name is 5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluorodecyl prop-2-enoate.
| Compound Name | 5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluorodecyl prop-2-enoate |
|---|---|
| PubChem CID | 52991911 |
| Molecular Formula | C13H11F13O2 |
| Molecular Weight | 446.20 g/mol |
| Exact Mass | 446.06 |
| IUPAC Name | 5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluorodecyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H11F13O2/c1-2-7(27)28-6-4-3-5-8(14,15)9(16,17)10(18,19)11(20,21)12(22,23)13(24,25)26/h2H,1,3-6H2 |
| InChIKey | UOJGGAYAADUVAH-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.20 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|