C11H9F11O4S — CID 140831611
2-(2,2,3,3,4,4,5,5,6,6,6-undecafluorohexylsulfonyl)ethyl prop-2-enoate (PubChem CID 140831611) has the molecular formula C11H9F11O4S and a molecular weight of 446.23 g/mol. Its IUPAC name is 2-(2,2,3,3,4,4,5,5,6,6,6-undecafluorohexylsulfonyl)ethyl prop-2-enoate.
| Compound Name | 2-(2,2,3,3,4,4,5,5,6,6,6-undecafluorohexylsulfonyl)ethyl prop-2-enoate |
|---|---|
| PubChem CID | 140831611 |
| Molecular Formula | C11H9F11O4S |
| Molecular Weight | 446.23 g/mol |
| Exact Mass | 446.00 |
| IUPAC Name | 2-(2,2,3,3,4,4,5,5,6,6,6-undecafluorohexylsulfonyl)ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCS(=O)(=O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H9F11O4S/c1-2-6(23)26-3-4-27(24,25)5-7(12,13)8(14,15)9(16,17)10(18,19)11(20,21)22/h2H,1,3-5H2 |
| InChIKey | LFAVNWNHJTYMFU-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.23 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|