C13H15F9O2 — CID 118106898
7,7,8,8,9,9,10,10,10-nonafluorodecyl prop-2-enoate (PubChem CID 118106898) has the molecular formula C13H15F9O2 and a molecular weight of 374.24 g/mol. Its IUPAC name is 7,7,8,8,9,9,10,10,10-nonafluorodecyl prop-2-enoate.
| Compound Name | 7,7,8,8,9,9,10,10,10-nonafluorodecyl prop-2-enoate |
|---|---|
| PubChem CID | 118106898 |
| Molecular Formula | C13H15F9O2 |
| Molecular Weight | 374.24 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | 7,7,8,8,9,9,10,10,10-nonafluorodecyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H15F9O2/c1-2-9(23)24-8-6-4-3-5-7-10(14,15)11(16,17)12(18,19)13(20,21)22/h2H,1,3-8H2 |
| InChIKey | YCKLYVMZDQPDKR-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.24 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|