C21H28O6 — CID 159187319
[5,5-di(prop-2-enoyl)-9-prop-2-enoyloxynonyl] prop-2-enoate (PubChem CID 159187319) has the molecular formula C21H28O6 and a molecular weight of 376.45 g/mol. Its IUPAC name is [5,5-di(prop-2-enoyl)-9-prop-2-enoyloxynonyl] prop-2-enoate.
| Compound Name | [5,5-di(prop-2-enoyl)-9-prop-2-enoyloxynonyl] prop-2-enoate |
|---|---|
| PubChem CID | 159187319 |
| Molecular Formula | C21H28O6 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | [5,5-di(prop-2-enoyl)-9-prop-2-enoyloxynonyl] prop-2-enoate |
| SMILES | C=CC(=O)OCCCCC(CCCCOC(=O)C=C)(C(=O)C=C)C(=O)C=C |
| InChI | InChI=1S/C21H28O6/c1-5-17(22)21(18(23)6-2,13-9-11-15-26-19(24)7-3)14-10-12-16-27-20(25)8-4/h5-8H,1-4,9-16H2 |
| InChIKey | DWVNRHUZCWBBNO-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|