C19H15F21O2 — CID 175788473
5,5,6,6,7,7,8,8,9,9,10,10,11,11,13,13,15,15,16,16,16-henicosafluorohexadecyl prop-2-enoate (PubChem CID 175788473) has the molecular formula C19H15F21O2 and a molecular weight of 674.28 g/mol. Its IUPAC name is 5,5,6,6,7,7,8,8,9,9,10,10,11,11,13,13,15,15,16,16,16-henicosafluorohexadecyl prop-2-enoate.
| Compound Name | 5,5,6,6,7,7,8,8,9,9,10,10,11,11,13,13,15,15,16,16,16-henicosafluorohexadecyl prop-2-enoate |
|---|---|
| PubChem CID | 175788473 |
| Molecular Formula | C19H15F21O2 |
| Molecular Weight | 674.28 g/mol |
| Exact Mass | 674.07 |
| IUPAC Name | 5,5,6,6,7,7,8,8,9,9,10,10,11,11,13,13,15,15,16,16,16-henicosafluorohexadecyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CC(F)(F)CC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C19H15F21O2/c1-2-9(41)42-6-4-3-5-11(22,23)14(28,29)16(32,33)18(36,37)17(34,35)15(30,31)12(24,25)7-10(20,21)8-13(26,27)19(38,39)40/h2H,1,3-8H2 |
| InChIKey | KXKPZNAUXRCJRZ-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.28 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|