C14H10F12O4 — CID 175891344
(3,3,4,4,5,5,6,6,7,7,8,8-dodecafluoro-8-prop-2-enoyloxyoctyl) prop-2-enoate (PubChem CID 175891344) has the molecular formula C14H10F12O4 and a molecular weight of 470.21 g/mol. Its IUPAC name is (3,3,4,4,5,5,6,6,7,7,8,8-dodecafluoro-8-prop-2-enoyloxyoctyl) prop-2-enoate.
| Compound Name | (3,3,4,4,5,5,6,6,7,7,8,8-dodecafluoro-8-prop-2-enoyloxyoctyl) prop-2-enoate |
|---|---|
| PubChem CID | 175891344 |
| Molecular Formula | C14H10F12O4 |
| Molecular Weight | 470.21 g/mol |
| Exact Mass | 470.04 |
| IUPAC Name | (3,3,4,4,5,5,6,6,7,7,8,8-dodecafluoro-8-prop-2-enoyloxyoctyl) prop-2-enoate |
| SMILES | C=CC(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)OC(=O)C=C |
| InChI | InChI=1S/C14H10F12O4/c1-3-7(27)29-6-5-9(15,16)10(17,18)11(19,20)12(21,22)13(23,24)14(25,26)30-8(28)4-2/h3-4H,1-2,5-6H2 |
| InChIKey | MXUMVSHKHNDRDT-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.21 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|