C13H11F13O2 — CID 175790972
1,1,2,2,3,3,4,4,5,5,10,10,10-tridecafluorodecyl prop-2-enoate (PubChem CID 175790972) has the molecular formula C13H11F13O2 and a molecular weight of 446.20 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,10,10,10-tridecafluorodecyl prop-2-enoate.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,10,10,10-tridecafluorodecyl prop-2-enoate |
|---|---|
| PubChem CID | 175790972 |
| Molecular Formula | C13H11F13O2 |
| Molecular Weight | 446.20 g/mol |
| Exact Mass | 446.06 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,10,10,10-tridecafluorodecyl prop-2-enoate |
| SMILES | C=CC(=O)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCCCC(F)(F)F |
| InChI | InChI=1S/C13H11F13O2/c1-2-7(27)28-13(25,26)12(23,24)11(21,22)10(19,20)8(14,15)5-3-4-6-9(16,17)18/h2H,1,3-6H2 |
| InChIKey | ARTOVPWSBJBDQU-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.20 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|