C15H11F17O2 — CID 87847189
1,1,2,2,3,3,4,4,5,5,6,6,7,7,12,12,12-heptadecafluorododecyl prop-2-enoate (PubChem CID 87847189) has the molecular formula C15H11F17O2 and a molecular weight of 546.22 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6,7,7,12,12,12-heptadecafluorododecyl prop-2-enoate.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,12,12,12-heptadecafluorododecyl prop-2-enoate |
|---|---|
| PubChem CID | 87847189 |
| Molecular Formula | C15H11F17O2 |
| Molecular Weight | 546.22 g/mol |
| Exact Mass | 546.05 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,12,12,12-heptadecafluorododecyl prop-2-enoate |
| SMILES | C=CC(=O)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCCCC(F)(F)F |
| InChI | InChI=1S/C15H11F17O2/c1-2-7(33)34-15(31,32)14(29,30)13(27,28)12(25,26)11(23,24)10(21,22)8(16,17)5-3-4-6-9(18,19)20/h2H,1,3-6H2 |
| InChIKey | NVYYCYBVCOTAMA-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.22 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|