C10H4F14O2 — CID 91461694
1,1,2,2,3,3,4,4,5,5,6,6,7,7-tetradecafluoroheptyl prop-2-enoate (PubChem CID 91461694) has the molecular formula C10H4F14O2 and a molecular weight of 422.11 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6,7,7-tetradecafluoroheptyl prop-2-enoate.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7-tetradecafluoroheptyl prop-2-enoate |
|---|---|
| PubChem CID | 91461694 |
| Molecular Formula | C10H4F14O2 |
| Molecular Weight | 422.11 g/mol |
| Exact Mass | 422.00 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7-tetradecafluoroheptyl prop-2-enoate |
| SMILES | C=CC(=O)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C10H4F14O2/c1-2-3(25)26-10(23,24)9(21,22)8(19,20)7(17,18)6(15,16)5(13,14)4(11)12/h2,4H,1H2 |
| InChIKey | JBNPWKFRCBKIRT-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.11 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|