C13H9F15O2 — CID 58729239
[4,4,5,5,6,6,7,7,8,8,9,9-dodecafluoro-3-(trifluoromethyl)nonyl] prop-2-enoate (PubChem CID 58729239) has the molecular formula C13H9F15O2 and a molecular weight of 482.18 g/mol. Its IUPAC name is [4,4,5,5,6,6,7,7,8,8,9,9-dodecafluoro-3-(trifluoromethyl)nonyl] prop-2-enoate.
| Compound Name | [4,4,5,5,6,6,7,7,8,8,9,9-dodecafluoro-3-(trifluoromethyl)nonyl] prop-2-enoate |
|---|---|
| PubChem CID | 58729239 |
| Molecular Formula | C13H9F15O2 |
| Molecular Weight | 482.18 g/mol |
| Exact Mass | 482.04 |
| IUPAC Name | [4,4,5,5,6,6,7,7,8,8,9,9-dodecafluoro-3-(trifluoromethyl)nonyl] prop-2-enoate |
| SMILES | C=CC(=O)OCCC(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C13H9F15O2/c1-2-6(29)30-4-3-5(10(20,21)22)8(16,17)11(23,24)13(27,28)12(25,26)9(18,19)7(14)15/h2,5,7H,1,3-4H2 |
| InChIKey | HYPLDNQULSGMDY-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.18 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|