C14H14F12O3 — CID 150825127
(6,6,7,7,8,8,9,9,10,10,11,11-dodecafluoro-1-hydroxyundecyl) prop-2-enoate (PubChem CID 150825127) has the molecular formula C14H14F12O3 and a molecular weight of 458.24 g/mol. Its IUPAC name is (6,6,7,7,8,8,9,9,10,10,11,11-dodecafluoro-1-hydroxyundecyl) prop-2-enoate.
| Compound Name | (6,6,7,7,8,8,9,9,10,10,11,11-dodecafluoro-1-hydroxyundecyl) prop-2-enoate |
|---|---|
| PubChem CID | 150825127 |
| Molecular Formula | C14H14F12O3 |
| Molecular Weight | 458.24 g/mol |
| Exact Mass | 458.08 |
| IUPAC Name | (6,6,7,7,8,8,9,9,10,10,11,11-dodecafluoro-1-hydroxyundecyl) prop-2-enoate |
| SMILES | C=CC(=O)OC(O)CCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C14H14F12O3/c1-2-7(27)29-8(28)5-3-4-6-10(17,18)12(21,22)14(25,26)13(23,24)11(19,20)9(15)16/h2,8-9,28H,1,3-6H2 |
| InChIKey | KKTLMEDLYNNIKG-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.24 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|